About (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one
(3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one (PubChem CID 8856687) has the molecular formula C15H8ClF2NO
and a molecular weight of 291.68 g/mol. Its IUPAC name is (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one |
| PubChem CID | 8856687 |
| Molecular Formula | C15H8ClF2NO |
| Molecular Weight | 291.68 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2/C1=C\c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H8ClF2NO/c16-9-2-3-10-11(15(20)19-14(10)7-9)5-8-1-4-12(17)13(18)6-8/h1-7H,(H,19,20)/b11-5+ |
| InChIKey | HGDNSKYZIZZSBL-VZUCSPMQSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one?
The IUPAC name of (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one (CID 8856687) is (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one.
What is the SMILES notation for (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one?
The canonical SMILES for (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one is O=C1Nc2cc(Cl)ccc2/C1=C\c1ccc(F)c(F)c1.
What is the InChIKey of (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one?
The InChIKey is HGDNSKYZIZZSBL-VZUCSPMQSA-N. The full InChI is InChI=1S/C15H8ClF2NO/c16-9-2-3-10-11(15(20)19-14(10)7-9)5-8-1-4-12(17)13(18)6-8/h1-7H,(H,19,20)/b11-5+.
What are the key properties of (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one?
(3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one has a molecular weight of 291.68 g/mol, XLogP of 4.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-6-chloro-3-[(3,4-difluorophenyl)methylidene]-1H-indol-2-one is sourced from PubChem (CID 8856687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).