C14H19NO4 — CID 88566890
3-[3a-(hydroxymethyl)-2-[(E)-3-oxoprop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]propanenitrile (PubChem CID 88566890) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-[3a-(hydroxymethyl)-2-[(E)-3-oxoprop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]propanenitrile.
| Compound Name | 3-[3a-(hydroxymethyl)-2-[(E)-3-oxoprop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]propanenitrile |
|---|---|
| PubChem CID | 88566890 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-[3a-(hydroxymethyl)-2-[(E)-3-oxoprop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]propanenitrile |
| SMILES | N#CCCC1CCC2OC(/C=C/C=O)CC2(CO)O1 |
| InChI | InChI=1S/C14H19NO4/c15-7-1-3-11-5-6-13-14(10-17,19-11)9-12(18-13)4-2-8-16/h2,4,8,11-13,17H,1,3,5-6,9-10H2/b4-2+ |
| InChIKey | ZAUWKBNRBFLNMG-DUXPYHPUSA-N |
| XLogP | 1.11 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|