C12H18O4 — CID 88566895
2-[(8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]ethanol (PubChem CID 88566895) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-[(8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]ethanol.
| Compound Name | 2-[(8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]ethanol |
|---|---|
| PubChem CID | 88566895 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-[(8R,9R,11R)-2,7,10-trioxatetracyclo[6.4.1.01,6.09,11]tridecan-3-yl]ethanol |
| SMILES | OCCC1CCC2O[C@@H]3CC2(C[C@H]2O[C@@H]32)O1 |
| InChI | InChI=1S/C12H18O4/c13-4-3-7-1-2-10-12(16-7)5-8(14-10)11-9(6-12)15-11/h7-11,13H,1-6H2/t7?,8-,9-,10?,11+,12?/m1/s1 |
| InChIKey | RVYVRKUWXLESTF-HQISSCKISA-N |
| XLogP | 0.62 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|