C42H37NO6 — CID 88566913
2-[1,2,2,4-tetramethyl-8-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-3,5,10,12-tetraen-1-yl)-9-oxochromeno[3,2-g]quinolin-6-yl]benzoic acid (PubChem CID 88566913) has the molecular formula C42H37NO6 and a molecular weight of 651.76 g/mol. Its IUPAC name is 2-[1,2,2,4-tetramethyl-8-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-3,5,10,12-tetraen-1-yl)-9-oxochromeno[3,2-g]quinolin-6-yl]benzoic acid.
| Compound Name | 2-[1,2,2,4-tetramethyl-8-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-3,5,10,12-tetraen-1-yl)-9-oxochromeno[3,2-g]quinolin-6-yl]benzoic acid |
|---|---|
| PubChem CID | 88566913 |
| Molecular Formula | C42H37NO6 |
| Molecular Weight | 651.76 g/mol |
| Exact Mass | 651.26 |
| IUPAC Name | 2-[1,2,2,4-tetramethyl-8-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-3,5,10,12-tetraen-1-yl)-9-oxochromeno[3,2-g]quinolin-6-yl]benzoic acid |
| SMILES | CC1=CC(C)(C)N(C)c2cc3oc4cc(=O)c(C56OOC(C)(C7C=CC=CC75)C5C=CC=CC56)cc-4c(-c4ccccc4C(=O)O)c3cc21 |
| InChI | InChI=1S/C42H37NO6/c1-23-22-40(2,3)43(5)34-20-36-27(18-26(23)34)38(24-12-6-7-13-25(24)39(45)46)28-19-33(35(44)21-37(28)47-36)42-31-16-10-8-14-29(31)41(4,48-49-42)30-15-9-11-17-32(30)42/h6-22,29-32H,1-5H3,(H,45,46) |
| InChIKey | WQPVXESHYCLVQM-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.76 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|