C19H20ClN5O2 — CID 88567441
N-(2-chloro-4-isocyanophenyl)-5-methyl-6-[[(5R)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]oxy]pyrimidin-4-amine (PubChem CID 88567441) has the molecular formula C19H20ClN5O2 and a molecular weight of 385.86 g/mol. Its IUPAC name is N-(2-chloro-4-isocyanophenyl)-5-methyl-6-[[(5R)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]oxy]pyrimidin-4-amine.
| Compound Name | N-(2-chloro-4-isocyanophenyl)-5-methyl-6-[[(5R)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]oxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 88567441 |
| Molecular Formula | C19H20ClN5O2 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-(2-chloro-4-isocyanophenyl)-5-methyl-6-[[(5R)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]oxy]pyrimidin-4-amine |
| SMILES | [C-]#[N+]c1ccc(Nc2ncnc(OC3CC4COC[C@@H](C3)N4)c2C)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClN5O2/c1-11-18(25-17-4-3-12(21-2)7-16(17)20)22-10-23-19(11)27-15-5-13-8-26-9-14(6-15)24-13/h3-4,7,10,13-15,24H,5-6,8-9H2,1H3,(H,22,23,25)/t13-,14?,15?/m1/s1 |
| InChIKey | VNHHSISKESFQMG-WLYUNCDWSA-N |
| XLogP | 3.63 |
| TPSA | 72.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|