C10H10N4O3S — CID 88568306
(9R,12R)-10,11-dihydroxy-15-oxa-1,2,3,8-tetrazatetracyclo[6.5.1.19,12.04,14]pentadeca-2,4(14),5-triene-7-thione (PubChem CID 88568306) has the molecular formula C10H10N4O3S and a molecular weight of 266.28 g/mol. Its IUPAC name is (9R,12R)-10,11-dihydroxy-15-oxa-1,2,3,8-tetrazatetracyclo[6.5.1.19,12.04,14]pentadeca-2,4(14),5-triene-7-thione.
| Compound Name | (9R,12R)-10,11-dihydroxy-15-oxa-1,2,3,8-tetrazatetracyclo[6.5.1.19,12.04,14]pentadeca-2,4(14),5-triene-7-thione |
|---|---|
| PubChem CID | 88568306 |
| Molecular Formula | C10H10N4O3S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (9R,12R)-10,11-dihydroxy-15-oxa-1,2,3,8-tetrazatetracyclo[6.5.1.19,12.04,14]pentadeca-2,4(14),5-triene-7-thione |
| SMILES | OC1C(O)[C@H]2Cn3nnc4ccc(=S)n(c43)[C@@H]1O2 |
| InChI | InChI=1S/C10H10N4O3S/c15-7-5-3-13-9-4(11-12-13)1-2-6(18)14(9)10(17-5)8(7)16/h1-2,5,7-8,10,15-16H,3H2/t5-,7?,8?,10-/m1/s1 |
| InChIKey | IVYSNHAFZBQCCE-AFBKUMPFSA-N |
| XLogP | -0.40 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|