C19H20O5S — CID 8856873
[(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate (PubChem CID 8856873) has the molecular formula C19H20O5S and a molecular weight of 360.43 g/mol. Its IUPAC name is [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate.
| Compound Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 8856873 |
| Molecular Formula | C19H20O5S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)O[C@H](C)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20O5S/c1-4-25(22,23)17-8-6-5-7-16(17)19(21)24-14(3)18(20)15-11-9-13(2)10-12-15/h5-12,14H,4H2,1-3H3/t14-/m1/s1 |
| InChIKey | KLPGHLCPNGWKEQ-CQSZACIVSA-N |
| XLogP | 3.22 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |