C15H20O6 — CID 88569088
(1R,2R,5S,6S,7R,10S)-2-formyloxy-10-hydroxy-6-(hydroxymethyl)-6-methyltricyclo[5.3.1.01,5]undec-8-ene-8-carboxylic acid (PubChem CID 88569088) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (1R,2R,5S,6S,7R,10S)-2-formyloxy-10-hydroxy-6-(hydroxymethyl)-6-methyltricyclo[5.3.1.01,5]undec-8-ene-8-carboxylic acid.
| Compound Name | (1R,2R,5S,6S,7R,10S)-2-formyloxy-10-hydroxy-6-(hydroxymethyl)-6-methyltricyclo[5.3.1.01,5]undec-8-ene-8-carboxylic acid |
|---|---|
| PubChem CID | 88569088 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (1R,2R,5S,6S,7R,10S)-2-formyloxy-10-hydroxy-6-(hydroxymethyl)-6-methyltricyclo[5.3.1.01,5]undec-8-ene-8-carboxylic acid |
| SMILES | C[C@@]1(CO)[C@H]2C[C@@]3([C@@H](O)C=C2C(=O)O)[C@H](OC=O)CC[C@@H]13 |
| InChI | InChI=1S/C15H20O6/c1-14(6-16)9-5-15(11(18)4-8(9)13(19)20)10(14)2-3-12(15)21-7-17/h4,7,9-12,16,18H,2-3,5-6H2,1H3,(H,19,20)/t9-,10-,11-,12+,14+,15+/m0/s1 |
| InChIKey | KHNWIAUDPMKHJV-WKKWAXIPSA-N |
| XLogP | 0.33 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|