C17H21F3N2OS2 — CID 88569144
(4-cyclopropyl-1,3-thiazol-2-yl)imino-[(3E,5E)-3-ethenyl-7,7,7-trifluoro-6-methylhepta-3,5-dien-2-yl]-methyl-oxo-λ6-sulfane (PubChem CID 88569144) has the molecular formula C17H21F3N2OS2 and a molecular weight of 390.50 g/mol. Its IUPAC name is (4-cyclopropyl-1,3-thiazol-2-yl)imino-[(3E,5E)-3-ethenyl-7,7,7-trifluoro-6-methylhepta-3,5-dien-2-yl]-methyl-oxo-λ6-sulfane.
| Compound Name | (4-cyclopropyl-1,3-thiazol-2-yl)imino-[(3E,5E)-3-ethenyl-7,7,7-trifluoro-6-methylhepta-3,5-dien-2-yl]-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 88569144 |
| Molecular Formula | C17H21F3N2OS2 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (4-cyclopropyl-1,3-thiazol-2-yl)imino-[(3E,5E)-3-ethenyl-7,7,7-trifluoro-6-methylhepta-3,5-dien-2-yl]-methyl-oxo-λ6-sulfane |
| SMILES | C=C/C(=C\C=C(/C)C(F)(F)F)C(C)S(C)(=O)=Nc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C17H21F3N2OS2/c1-5-13(7-6-11(2)17(18,19)20)12(3)25(4,23)22-16-21-15(10-24-16)14-8-9-14/h5-7,10,12,14H,1,8-9H2,2-4H3/b11-6+,13-7+ |
| InChIKey | NZVXORYQDAWNLY-NBPRNCBBSA-N |
| XLogP | 5.76 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|