C15H19F6N5O — CID 88569190
1,1,1,3,3,3-hexafluoro-2-methyl-N-[1-[2-(6-morpholin-4-yl-3-pyridinyl)hydrazinyl]ethenyl]propan-2-amine (PubChem CID 88569190) has the molecular formula C15H19F6N5O and a molecular weight of 399.34 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-methyl-N-[1-[2-(6-morpholin-4-yl-3-pyridinyl)hydrazinyl]ethenyl]propan-2-amine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-methyl-N-[1-[2-(6-morpholin-4-yl-3-pyridinyl)hydrazinyl]ethenyl]propan-2-amine |
|---|---|
| PubChem CID | 88569190 |
| Molecular Formula | C15H19F6N5O |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-methyl-N-[1-[2-(6-morpholin-4-yl-3-pyridinyl)hydrazinyl]ethenyl]propan-2-amine |
| SMILES | C=C(NNc1ccc(N2CCOCC2)nc1)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H19F6N5O/c1-10(23-13(2,14(16,17)18)15(19,20)21)24-25-11-3-4-12(22-9-11)26-5-7-27-8-6-26/h3-4,9,23-25H,1,5-8H2,2H3 |
| InChIKey | HBDWWEVOIOMGIS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|