C36H30N4O — CID 88569203
1-[4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1-[4-(4-pyrido[4,3-b]indol-5-ylphenoxy)phenyl]pyrrol-3-yl]-N-ethenylmethanimine (PubChem CID 88569203) has the molecular formula C36H30N4O and a molecular weight of 534.66 g/mol. Its IUPAC name is 1-[4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1-[4-(4-pyrido[4,3-b]indol-5-ylphenoxy)phenyl]pyrrol-3-yl]-N-ethenylmethanimine.
| Compound Name | 1-[4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1-[4-(4-pyrido[4,3-b]indol-5-ylphenoxy)phenyl]pyrrol-3-yl]-N-ethenylmethanimine |
|---|---|
| PubChem CID | 88569203 |
| Molecular Formula | C36H30N4O |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 1-[4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1-[4-(4-pyrido[4,3-b]indol-5-ylphenoxy)phenyl]pyrrol-3-yl]-N-ethenylmethanimine |
| SMILES | C=C/C=C\c1c(/C=N/C=C)c(C)n(-c2ccc(Oc3ccc(-n4c5ccccc5c5cnccc54)cc3)cc2)c1C |
| InChI | InChI=1S/C36H30N4O/c1-5-7-10-31-25(3)39(26(4)33(31)23-37-6-2)27-13-17-29(18-14-27)41-30-19-15-28(16-20-30)40-35-12-9-8-11-32(35)34-24-38-22-21-36(34)40/h5-24H,1-2H2,3-4H3/b10-7-,37-23+ |
| InChIKey | FQTBMYPACGWIRH-FJRAMTGISA-N |
| XLogP | 9.14 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|