C14H17ClN2 — CID 88569346
5-chloro-4-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 88569346) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 5-chloro-4-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-chloro-4-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 88569346 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 5-chloro-4-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C/C=C(C)\C=C(/C)C1=c2cc[nH]c2=NCC1Cl |
| InChI | InChI=1S/C14H17ClN2/c1-4-9(2)7-10(3)13-11-5-6-16-14(11)17-8-12(13)15/h4-7,12H,8H2,1-3H3,(H,16,17)/b9-4-,10-7+ |
| InChIKey | HGYSQTWJYHDJMT-SWSBUGGLSA-N |
| XLogP | 2.32 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|