C32H48S2 — CID 88569386
(3Z,5Z,6E,8E)-10-(2,6-ditert-butylthiopyran-4-ylidene)-5-(3,3-dimethyl-2-methylidenebutylidene)-2,2-dimethyldeca-3,6,8-triene-3-thiol (PubChem CID 88569386) has the molecular formula C32H48S2 and a molecular weight of 496.87 g/mol. Its IUPAC name is (3Z,5Z,6E,8E)-10-(2,6-ditert-butylthiopyran-4-ylidene)-5-(3,3-dimethyl-2-methylidenebutylidene)-2,2-dimethyldeca-3,6,8-triene-3-thiol.
| Compound Name | (3Z,5Z,6E,8E)-10-(2,6-ditert-butylthiopyran-4-ylidene)-5-(3,3-dimethyl-2-methylidenebutylidene)-2,2-dimethyldeca-3,6,8-triene-3-thiol |
|---|---|
| PubChem CID | 88569386 |
| Molecular Formula | C32H48S2 |
| Molecular Weight | 496.87 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | (3Z,5Z,6E,8E)-10-(2,6-ditert-butylthiopyran-4-ylidene)-5-(3,3-dimethyl-2-methylidenebutylidene)-2,2-dimethyldeca-3,6,8-triene-3-thiol |
| SMILES | C=C(/C=C(\C=C(/S)C(C)(C)C)/C=C/C=C/C=C1C=C(C(C)(C)C)SC(C(C)(C)C)=C1)C(C)(C)C |
| InChI | InChI=1S/C32H48S2/c1-23(29(2,3)4)19-24(20-26(33)30(5,6)7)17-15-14-16-18-25-21-27(31(8,9)10)34-28(22-25)32(11,12)13/h14-22,33H,1H2,2-13H3/b16-14+,17-15+,24-19-,26-20- |
| InChIKey | QHCNBBUZQJMFSI-YLXJQTQUSA-N |
| XLogP | 11.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.87 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|