About 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid
2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid (PubChem CID 88570268) has the molecular formula C15H24F2O5S
and a molecular weight of 354.42 g/mol. Its IUPAC name is 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid.
Molecular Properties
| Compound Name | 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid |
| PubChem CID | 88570268 |
| Molecular Formula | C15H24F2O5S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid |
| SMILES | CCC1(O)C2CC3CC1CC(C2)C3COCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C15H24F2O5S/c1-2-14(18)11-3-9-4-12(14)6-10(5-11)13(9)7-22-8-15(16,17)23(19,20)21/h9-13,18H,2-8H2,1H3,(H,19,20,21) |
| InChIKey | XIRKUVMOVOEKBZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid?
The IUPAC name of 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid (CID 88570268) is 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid.
What is the SMILES notation for 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid?
The canonical SMILES for 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid is CCC1(O)C2CC3CC1CC(C2)C3COCC(F)(F)S(=O)(=O)O.
What is the InChIKey of 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid?
The InChIKey is XIRKUVMOVOEKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F2O5S/c1-2-14(18)11-3-9-4-12(14)6-10(5-11)13(9)7-22-8-15(16,17)23(19,20)21/h9-13,18H,2-8H2,1H3,(H,19,20,21).
What are the key properties of 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid?
2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid has a molecular weight of 354.42 g/mol, XLogP of 2.31, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-ethyl-6-hydroxy-2-adamantyl)methoxy]-1,1-difluoroethanesulfonic acid is sourced from PubChem (CID 88570268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).