C10H17NO2 — CID 88570337
(2E,4Z)-N-methoxy-N,2,3-trimethylhexa-2,4-dienamide (PubChem CID 88570337) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (2E,4Z)-N-methoxy-N,2,3-trimethylhexa-2,4-dienamide.
| Compound Name | (2E,4Z)-N-methoxy-N,2,3-trimethylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 88570337 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (2E,4Z)-N-methoxy-N,2,3-trimethylhexa-2,4-dienamide |
| SMILES | C/C=C\C(C)=C(/C)C(=O)N(C)OC |
| InChI | InChI=1S/C10H17NO2/c1-6-7-8(2)9(3)10(12)11(4)13-5/h6-7H,1-5H3/b7-6-,9-8+ |
| InChIKey | ZANAGWZJZMHGPN-NMMTYZSQSA-N |
| XLogP | 1.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|