C10H13N5O3S — CID 88570344
(9R,11R)-11-(1-hydroxyethyl)-9-methyl-5-sulfanylidene-10-oxa-1,2,3,6,8-pentazatricyclo[6.4.1.04,13]trideca-2,4(13)-dien-7-one (PubChem CID 88570344) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is (9R,11R)-11-(1-hydroxyethyl)-9-methyl-5-sulfanylidene-10-oxa-1,2,3,6,8-pentazatricyclo[6.4.1.04,13]trideca-2,4(13)-dien-7-one.
| Compound Name | (9R,11R)-11-(1-hydroxyethyl)-9-methyl-5-sulfanylidene-10-oxa-1,2,3,6,8-pentazatricyclo[6.4.1.04,13]trideca-2,4(13)-dien-7-one |
|---|---|
| PubChem CID | 88570344 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (9R,11R)-11-(1-hydroxyethyl)-9-methyl-5-sulfanylidene-10-oxa-1,2,3,6,8-pentazatricyclo[6.4.1.04,13]trideca-2,4(13)-dien-7-one |
| SMILES | CC(O)[C@@H]1Cn2nnc3c(=S)[nH]c(=O)n(c32)[C@@H](C)O1 |
| InChI | InChI=1S/C10H13N5O3S/c1-4(16)6-3-14-9-7(12-13-14)8(19)11-10(17)15(9)5(2)18-6/h4-6,16H,3H2,1-2H3,(H,11,17,19)/t4?,5-,6+/m1/s1 |
| InChIKey | MPJGOWJVNAKSJO-UVCATTPVSA-N |
| XLogP | -0.05 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|