C18H21Br2NO4 — CID 88570393
1-[(2,6-dibromo-3-hydroxy-4-methoxyphenyl)methyl]-2-(hydroxymethyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one (PubChem CID 88570393) has the molecular formula C18H21Br2NO4 and a molecular weight of 475.18 g/mol. Its IUPAC name is 1-[(2,6-dibromo-3-hydroxy-4-methoxyphenyl)methyl]-2-(hydroxymethyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one.
| Compound Name | 1-[(2,6-dibromo-3-hydroxy-4-methoxyphenyl)methyl]-2-(hydroxymethyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 88570393 |
| Molecular Formula | C18H21Br2NO4 |
| Molecular Weight | 475.18 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | 1-[(2,6-dibromo-3-hydroxy-4-methoxyphenyl)methyl]-2-(hydroxymethyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one |
| SMILES | COc1cc(Br)c(CC2C3=C(CCN2CO)CC(=O)CC3)c(Br)c1O |
| InChI | InChI=1S/C18H21Br2NO4/c1-25-16-8-14(19)13(17(20)18(16)24)7-15-12-3-2-11(23)6-10(12)4-5-21(15)9-22/h8,15,22,24H,2-7,9H2,1H3 |
| InChIKey | QPSBKSQGDPSXQS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|