C9H11BrF2 — CID 88570737
(3E,5E)-5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene (PubChem CID 88570737) has the molecular formula C9H11BrF2 and a molecular weight of 237.09 g/mol. Its IUPAC name is (3E,5E)-5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene.
| Compound Name | (3E,5E)-5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 88570737 |
| Molecular Formula | C9H11BrF2 |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | (3E,5E)-5-bromo-3-(difluoromethyl)-2-methylhepta-1,3,5-triene |
| SMILES | C=C(C)/C(=C\C(Br)=C/C)C(F)F |
| InChI | InChI=1S/C9H11BrF2/c1-4-7(10)5-8(6(2)3)9(11)12/h4-5,9H,2H2,1,3H3/b7-4+,8-5+ |
| InChIKey | XAEVJYOEHRHWPR-NSLJXJERSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|