About 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol
5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol (PubChem CID 88570766) has the molecular formula C6H12N2S
and a molecular weight of 144.24 g/mol. Its IUPAC name is 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol.
Molecular Properties
| Compound Name | 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol |
| PubChem CID | 88570766 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol |
| SMILES | CNC1=C(S)CCNC1 |
| InChI | InChI=1S/C6H12N2S/c1-7-5-4-8-3-2-6(5)9/h7-9H,2-4H2,1H3 |
| InChIKey | REXFBAMDTNTMIO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol?
The IUPAC name of 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol (CID 88570766) is 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol.
What is the SMILES notation for 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol?
The canonical SMILES for 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol is CNC1=C(S)CCNC1.
What is the InChIKey of 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol?
The InChIKey is REXFBAMDTNTMIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S/c1-7-5-4-8-3-2-6(5)9/h7-9H,2-4H2,1H3.
What are the key properties of 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol?
5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol has a molecular weight of 144.24 g/mol, XLogP of 0.34, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylamino)-1,2,3,6-tetrahydropyridine-4-thiol is sourced from PubChem (CID 88570766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).