C11H16F2 — CID 88571347
(3Z,5E)-5-(difluoromethyl)-2,6-dimethylocta-1,3,5-triene (PubChem CID 88571347) has the molecular formula C11H16F2 and a molecular weight of 186.24 g/mol. Its IUPAC name is (3Z,5E)-5-(difluoromethyl)-2,6-dimethylocta-1,3,5-triene.
| Compound Name | (3Z,5E)-5-(difluoromethyl)-2,6-dimethylocta-1,3,5-triene |
|---|---|
| PubChem CID | 88571347 |
| Molecular Formula | C11H16F2 |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (3Z,5E)-5-(difluoromethyl)-2,6-dimethylocta-1,3,5-triene |
| SMILES | C=C(C)/C=C\C(=C(\C)CC)C(F)F |
| InChI | InChI=1S/C11H16F2/c1-5-9(4)10(11(12)13)7-6-8(2)3/h6-7,11H,2,5H2,1,3-4H3/b7-6-,10-9+ |
| InChIKey | GOOBIKUGNRJJFM-IXWMQOLASA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|