About (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde
(3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde (PubChem CID 88571405) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde.
Molecular Properties
| Compound Name | (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde |
| PubChem CID | 88571405 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde |
| SMILES | N[C@@H]1CC=C(C=O)OC1 |
| InChI | InChI=1S/C6H9NO2/c7-5-1-2-6(3-8)9-4-5/h2-3,5H,1,4,7H2/t5-/m1/s1 |
| InChIKey | XMMBOZRCANABIO-RXMQYKEDSA-N |
| XLogP | -0.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde?
The IUPAC name of (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde (CID 88571405) is (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde.
What is the SMILES notation for (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde?
The canonical SMILES for (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde is N[C@@H]1CC=C(C=O)OC1.
What is the InChIKey of (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde?
The InChIKey is XMMBOZRCANABIO-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H9NO2/c7-5-1-2-6(3-8)9-4-5/h2-3,5H,1,4,7H2/t5-/m1/s1.
What are the key properties of (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde?
(3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde has a molecular weight of 127.14 g/mol, XLogP of -0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-3,4-dihydro-2H-pyran-6-carbaldehyde is sourced from PubChem (CID 88571405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).