C20H24O6 — CID 88571435
(4R,6S,8S,11E)-17,19-dihydroxy-4-propyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione (PubChem CID 88571435) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (4R,6S,8S,11E)-17,19-dihydroxy-4-propyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione.
| Compound Name | (4R,6S,8S,11E)-17,19-dihydroxy-4-propyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione |
|---|---|
| PubChem CID | 88571435 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (4R,6S,8S,11E)-17,19-dihydroxy-4-propyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),11,16,18-tetraene-2,13-dione |
| SMILES | CCC[C@@H]1C[C@@H]2O[C@H]2CC/C=C/C(=O)Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C20H24O6/c1-2-5-15-11-18-17(26-18)7-4-3-6-13(21)8-12-9-14(22)10-16(23)19(12)20(24)25-15/h3,6,9-10,15,17-18,22-23H,2,4-5,7-8,11H2,1H3/b6-3+/t15-,17+,18+/m1/s1 |
| InChIKey | MZGURQHCAKALJI-CJQDLWCSSA-N |
| XLogP | 3.04 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|