C24H24ClN2O9PS2 — CID 88571491
1-[(4aR,6R)-2-(2-chlorophenoxy)-7-hydroxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-[2-(4-methylphenyl)sulfonylethoxy]pyrimidin-2-one (PubChem CID 88571491) has the molecular formula C24H24ClN2O9PS2 and a molecular weight of 615.02 g/mol. Its IUPAC name is 1-[(4aR,6R)-2-(2-chlorophenoxy)-7-hydroxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-[2-(4-methylphenyl)sulfonylethoxy]pyrimidin-2-one.
| Compound Name | 1-[(4aR,6R)-2-(2-chlorophenoxy)-7-hydroxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-[2-(4-methylphenyl)sulfonylethoxy]pyrimidin-2-one |
|---|---|
| PubChem CID | 88571491 |
| Molecular Formula | C24H24ClN2O9PS2 |
| Molecular Weight | 615.02 g/mol |
| Exact Mass | 614.03 |
| IUPAC Name | 1-[(4aR,6R)-2-(2-chlorophenoxy)-7-hydroxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-[2-(4-methylphenyl)sulfonylethoxy]pyrimidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)CCOc2ccn([C@@H]3O[C@@H]4COP(=S)(Oc5ccccc5Cl)OC4C3O)c(=O)n2)cc1 |
| InChI | InChI=1S/C24H24ClN2O9PS2/c1-15-6-8-16(9-7-15)39(30,31)13-12-32-20-10-11-27(24(29)26-20)23-21(28)22-19(34-23)14-33-37(38,36-22)35-18-5-3-2-4-17(18)25/h2-11,19,21-23,28H,12-14H2,1H3/t19-,21?,22?,23-,37?/m1/s1 |
| InChIKey | KMKCIGSZRAZMOE-NNNBXQHUSA-N |
| XLogP | 3.04 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.02 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|