C19H14F14O8 — CID 88571547
[1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-(2-prop-2-enoyloxyacetyl)oxycyclohexyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 88571547) has the molecular formula C19H14F14O8 and a molecular weight of 636.29 g/mol. Its IUPAC name is [1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-(2-prop-2-enoyloxyacetyl)oxycyclohexyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-(2-prop-2-enoyloxyacetyl)oxycyclohexyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 88571547 |
| Molecular Formula | C19H14F14O8 |
| Molecular Weight | 636.29 g/mol |
| Exact Mass | 636.05 |
| IUPAC Name | [1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-2-(2-prop-2-enoyloxyacetyl)oxycyclohexyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | C=CC(=O)OCC(=O)OC1CCCCC1(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H14F14O8/c1-2-9(34)38-7-10(35)39-8-5-3-4-6-13(8,40-11(36)14(20,21)16(24,25)18(28,29)30)41-12(37)15(22,23)17(26,27)19(31,32)33/h2,8H,1,3-7H2 |
| InChIKey | HBEWAYRYSOGSEI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|