About 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine
1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine (PubChem CID 88571561) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine |
| PubChem CID | 88571561 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine |
| SMILES | C=C/C=C(\C=C/C)CN1CCCC1 |
| InChI | InChI=1S/C12H19N/c1-3-7-12(8-4-2)11-13-9-5-6-10-13/h3-4,7-8H,1,5-6,9-11H2,2H3/b8-4-,12-7+ |
| InChIKey | JWOOCOXOAAXAEZ-OPVKSPCESA-N |
| XLogP | 2.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine?
The IUPAC name of 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine (CID 88571561) is 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine.
What is the SMILES notation for 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine?
The canonical SMILES for 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine is C=C/C=C(\C=C/C)CN1CCCC1.
What is the InChIKey of 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine?
The InChIKey is JWOOCOXOAAXAEZ-OPVKSPCESA-N. The full InChI is InChI=1S/C12H19N/c1-3-7-12(8-4-2)11-13-9-5-6-10-13/h3-4,7-8H,1,5-6,9-11H2,2H3/b8-4-,12-7+.
What are the key properties of 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine?
1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine has a molecular weight of 177.29 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]pyrrolidine is sourced from PubChem (CID 88571561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).