C11H14BrNS — CID 88571567
4-[(3Z,5E)-5-bromohepta-1,3,5-trien-2-yl]-5-methyl-4,5-dihydro-1,3-thiazole (PubChem CID 88571567) has the molecular formula C11H14BrNS and a molecular weight of 272.21 g/mol. Its IUPAC name is 4-[(3Z,5E)-5-bromohepta-1,3,5-trien-2-yl]-5-methyl-4,5-dihydro-1,3-thiazole.
| Compound Name | 4-[(3Z,5E)-5-bromohepta-1,3,5-trien-2-yl]-5-methyl-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 88571567 |
| Molecular Formula | C11H14BrNS |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 4-[(3Z,5E)-5-bromohepta-1,3,5-trien-2-yl]-5-methyl-4,5-dihydro-1,3-thiazole |
| SMILES | C=C(/C=C\C(Br)=C/C)C1N=CSC1C |
| InChI | InChI=1S/C11H14BrNS/c1-4-10(12)6-5-8(2)11-9(3)14-7-13-11/h4-7,9,11H,2H2,1,3H3/b6-5-,10-4+ |
| InChIKey | NEZQBRUPYVYZBN-QYONPMAVSA-N |
| XLogP | 3.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|