C29H34N4O — CID 88571602
1-[(6E)-6-[[amino(benzyl)amino]methylidene]-5-methylidenecyclohexa-1,3-dien-1-yl]-3-[(1R)-5-tert-butyl-2,3-dihydro-1H-inden-1-yl]urea (PubChem CID 88571602) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is 1-[(6E)-6-[[amino(benzyl)amino]methylidene]-5-methylidenecyclohexa-1,3-dien-1-yl]-3-[(1R)-5-tert-butyl-2,3-dihydro-1H-inden-1-yl]urea.
| Compound Name | 1-[(6E)-6-[[amino(benzyl)amino]methylidene]-5-methylidenecyclohexa-1,3-dien-1-yl]-3-[(1R)-5-tert-butyl-2,3-dihydro-1H-inden-1-yl]urea |
|---|---|
| PubChem CID | 88571602 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1-[(6E)-6-[[amino(benzyl)amino]methylidene]-5-methylidenecyclohexa-1,3-dien-1-yl]-3-[(1R)-5-tert-butyl-2,3-dihydro-1H-inden-1-yl]urea |
| SMILES | C=c1cccc(NC(=O)N[C@@H]2CCc3cc(C(C)(C)C)ccc32)/c1=C/N(N)Cc1ccccc1 |
| InChI | InChI=1S/C29H34N4O/c1-20-9-8-12-26(25(20)19-33(30)18-21-10-6-5-7-11-21)31-28(34)32-27-16-13-22-17-23(29(2,3)4)14-15-24(22)27/h5-12,14-15,17,19,27H,1,13,16,18,30H2,2-4H3,(H2,31,32,34)/b25-19+/t27-/m1/s1 |
| InChIKey | SQCWOPACOJWZGP-BSGTYYGESA-N |
| XLogP | 4.32 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|