C13H21N — CID 88571618
(3R)-3-methyl-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]pyrrolidine (PubChem CID 88571618) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (3R)-3-methyl-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]pyrrolidine.
| Compound Name | (3R)-3-methyl-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]pyrrolidine |
|---|---|
| PubChem CID | 88571618 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (3R)-3-methyl-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]pyrrolidine |
| SMILES | C/C=C\C=C/C=C/CN1CC[C@@H](C)C1 |
| InChI | InChI=1S/C13H21N/c1-3-4-5-6-7-8-10-14-11-9-13(2)12-14/h3-8,13H,9-12H2,1-2H3/b4-3-,6-5-,8-7+/t13-/m1/s1 |
| InChIKey | SZAIEQRTMNABIQ-ZZLHSNQQSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|