C23H27N3O4 — CID 88571824
4-[(1E,3Z)-1-amino-5-(2-methylpropoxy)hexa-1,3,5-trien-2-yl]oxy-3-(2-methoxy-3-pyridinyl)benzamide (PubChem CID 88571824) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-[(1E,3Z)-1-amino-5-(2-methylpropoxy)hexa-1,3,5-trien-2-yl]oxy-3-(2-methoxy-3-pyridinyl)benzamide.
| Compound Name | 4-[(1E,3Z)-1-amino-5-(2-methylpropoxy)hexa-1,3,5-trien-2-yl]oxy-3-(2-methoxy-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 88571824 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 4-[(1E,3Z)-1-amino-5-(2-methylpropoxy)hexa-1,3,5-trien-2-yl]oxy-3-(2-methoxy-3-pyridinyl)benzamide |
| SMILES | C=C(/C=C\C(=C/N)Oc1ccc(C(N)=O)cc1-c1cccnc1OC)OCC(C)C |
| InChI | InChI=1S/C23H27N3O4/c1-15(2)14-29-16(3)7-9-18(13-24)30-21-10-8-17(22(25)27)12-20(21)19-6-5-11-26-23(19)28-4/h5-13,15H,3,14,24H2,1-2,4H3,(H2,25,27)/b9-7-,18-13+ |
| InChIKey | GGOLCOGAXZMOBG-FGQDEARFSA-N |
| XLogP | 3.78 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|