C22H27Cl2N5O3 — CID 88571874
[(3S)-1-[N-cyano-N'-[(2S)-4-(5,7-dichloro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-methyl-4-oxobutyl]carbamimidoyl]pyrrolidin-3-yl] acetate (PubChem CID 88571874) has the molecular formula C22H27Cl2N5O3 and a molecular weight of 480.40 g/mol. Its IUPAC name is [(3S)-1-[N-cyano-N'-[(2S)-4-(5,7-dichloro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-methyl-4-oxobutyl]carbamimidoyl]pyrrolidin-3-yl] acetate.
| Compound Name | [(3S)-1-[N-cyano-N'-[(2S)-4-(5,7-dichloro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-methyl-4-oxobutyl]carbamimidoyl]pyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 88571874 |
| Molecular Formula | C22H27Cl2N5O3 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | [(3S)-1-[N-cyano-N'-[(2S)-4-(5,7-dichloro-1,2,3,4-tetrahydroisoquinolin-6-yl)-2-methyl-4-oxobutyl]carbamimidoyl]pyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCN(/C(=N/C[C@@H](C)CC(=O)c2c(Cl)cc3c(c2Cl)CCNC3)NC#N)C1 |
| InChI | InChI=1S/C22H27Cl2N5O3/c1-13(9-27-22(28-12-25)29-6-4-16(11-29)32-14(2)30)7-19(31)20-18(23)8-15-10-26-5-3-17(15)21(20)24/h8,13,16,26H,3-7,9-11H2,1-2H3,(H,27,28)/t13-,16-/m0/s1 |
| InChIKey | CZVJVTZRVTUKAG-BBRMVZONSA-N |
| XLogP | 2.91 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|