C10H15N3 — CID 88572089
(2Z,4Z)-2-amino-N'-prop-1-en-2-ylhepta-2,4,6-trienimidamide (PubChem CID 88572089) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is (2Z,4Z)-2-amino-N'-prop-1-en-2-ylhepta-2,4,6-trienimidamide.
| Compound Name | (2Z,4Z)-2-amino-N'-prop-1-en-2-ylhepta-2,4,6-trienimidamide |
|---|---|
| PubChem CID | 88572089 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (2Z,4Z)-2-amino-N'-prop-1-en-2-ylhepta-2,4,6-trienimidamide |
| SMILES | C=C/C=C\C=C(N)\C(N)=N\C(=C)C |
| InChI | InChI=1S/C10H15N3/c1-4-5-6-7-9(11)10(12)13-8(2)3/h4-7H,1-2,11H2,3H3,(H2,12,13)/b6-5-,9-7- |
| InChIKey | LHLWZXCNMYGEIR-LZWBOMALSA-N |
| XLogP | 1.46 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|