About 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide
2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide (PubChem CID 88572366) has the molecular formula C12H17BrN2O
and a molecular weight of 285.19 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide |
| PubChem CID | 88572366 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide |
| SMILES | CC(C)C(C)(/C(N)=N/O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H17BrN2O/c1-8(2)12(3,11(14)15-16)9-4-6-10(13)7-5-9/h4-8,16H,1-3H3,(H2,14,15) |
| InChIKey | YUNDJJOKSVASCH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide?
The IUPAC name of 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide (CID 88572366) is 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide.
What is the SMILES notation for 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide?
The canonical SMILES for 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide is CC(C)C(C)(/C(N)=N/O)c1ccc(Br)cc1.
What is the InChIKey of 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide?
The InChIKey is YUNDJJOKSVASCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2O/c1-8(2)12(3,11(14)15-16)9-4-6-10(13)7-5-9/h4-8,16H,1-3H3,(H2,14,15).
What are the key properties of 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide?
2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide has a molecular weight of 285.19 g/mol, XLogP of 3.11, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide is sourced from PubChem (CID 88572366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).