C38H34F6N2O2 — CID 88572618
2-[2-[4-[2-[4-[2-cyano-3-(2-methylbutan-2-yl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]propan-2-yl]-6-methylbenzonitrile (PubChem CID 88572618) has the molecular formula C38H34F6N2O2 and a molecular weight of 664.69 g/mol. Its IUPAC name is 2-[2-[4-[2-[4-[2-cyano-3-(2-methylbutan-2-yl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]propan-2-yl]-6-methylbenzonitrile.
| Compound Name | 2-[2-[4-[2-[4-[2-cyano-3-(2-methylbutan-2-yl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]propan-2-yl]-6-methylbenzonitrile |
|---|---|
| PubChem CID | 88572618 |
| Molecular Formula | C38H34F6N2O2 |
| Molecular Weight | 664.69 g/mol |
| Exact Mass | 664.25 |
| IUPAC Name | 2-[2-[4-[2-[4-[2-cyano-3-(2-methylbutan-2-yl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]propan-2-yl]-6-methylbenzonitrile |
| SMILES | CCC(C)(C)c1cccc(Oc2ccc(C(c3ccc(OC(C)(C)c4cccc(C)c4C#N)cc3)(C(F)(F)F)C(F)(F)F)cc2)c1C#N |
| InChI | InChI=1S/C38H34F6N2O2/c1-7-34(3,4)31-11-9-13-33(30(31)23-46)47-27-18-14-25(15-19-27)36(37(39,40)41,38(42,43)44)26-16-20-28(21-17-26)48-35(5,6)32-12-8-10-24(2)29(32)22-45/h8-21H,7H2,1-6H3 |
| InChIKey | AWWGQTHNQIACSG-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.69 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |