C22H18Cl2F7N5O3 — CID 88573308
2-[2,6-dichloro-3-[[(2,2-difluoroacetyl)amino]methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide (PubChem CID 88573308) has the molecular formula C22H18Cl2F7N5O3 and a molecular weight of 604.31 g/mol. Its IUPAC name is 2-[2,6-dichloro-3-[[(2,2-difluoroacetyl)amino]methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide.
| Compound Name | 2-[2,6-dichloro-3-[[(2,2-difluoroacetyl)amino]methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 88573308 |
| Molecular Formula | C22H18Cl2F7N5O3 |
| Molecular Weight | 604.31 g/mol |
| Exact Mass | 603.07 |
| IUPAC Name | 2-[2,6-dichloro-3-[[(2,2-difluoroacetyl)amino]methyl]anilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide |
| SMILES | Cn1c(Nc2c(Cl)ccc(CNC(=O)C(F)F)c2Cl)nc2cc(C(=O)NCC(F)(F)F)c(OCC(F)F)cc21 |
| InChI | InChI=1S/C22H18Cl2F7N5O3/c1-36-13-5-14(39-7-15(25)26)10(19(37)33-8-22(29,30)31)4-12(13)34-21(36)35-17-11(23)3-2-9(16(17)24)6-32-20(38)18(27)28/h2-5,15,18H,6-8H2,1H3,(H,32,38)(H,33,37)(H,34,35) |
| InChIKey | UWGOCQZJAGIPKY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.31 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |