C23H20Cl2F8N6O3 — CID 88573411
2-[3-[[(2-amino-3,3,3-trifluoropropanoyl)amino]methyl]-2,6-dichloroanilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide (PubChem CID 88573411) has the molecular formula C23H20Cl2F8N6O3 and a molecular weight of 651.34 g/mol. Its IUPAC name is 2-[3-[[(2-amino-3,3,3-trifluoropropanoyl)amino]methyl]-2,6-dichloroanilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide.
| Compound Name | 2-[3-[[(2-amino-3,3,3-trifluoropropanoyl)amino]methyl]-2,6-dichloroanilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 88573411 |
| Molecular Formula | C23H20Cl2F8N6O3 |
| Molecular Weight | 651.34 g/mol |
| Exact Mass | 650.08 |
| IUPAC Name | 2-[3-[[(2-amino-3,3,3-trifluoropropanoyl)amino]methyl]-2,6-dichloroanilino]-6-(2,2-difluoroethoxy)-1-methyl-N-(2,2,2-trifluoroethyl)benzimidazole-5-carboxamide |
| SMILES | Cn1c(Nc2c(Cl)ccc(CNC(=O)C(N)C(F)(F)F)c2Cl)nc2cc(C(=O)NCC(F)(F)F)c(OCC(F)F)cc21 |
| InChI | InChI=1S/C23H20Cl2F8N6O3/c1-39-13-5-14(42-7-15(26)27)10(19(40)36-8-22(28,29)30)4-12(13)37-21(39)38-17-11(24)3-2-9(16(17)25)6-35-20(41)18(34)23(31,32)33/h2-5,15,18H,6-8,34H2,1H3,(H,35,41)(H,36,40)(H,37,38) |
| InChIKey | PDNJPIYJKQMFDZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |