About 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine
2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine (PubChem CID 88573481) has the molecular formula C10H5F6NO
and a molecular weight of 269.14 g/mol. Its IUPAC name is 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine |
| PubChem CID | 88573481 |
| Molecular Formula | C10H5F6NO |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine |
| SMILES | Cc1oc2nc(C(F)(F)F)ccc2c1C(F)(F)F |
| InChI | InChI=1S/C10H5F6NO/c1-4-7(10(14,15)16)5-2-3-6(9(11,12)13)17-8(5)18-4/h2-3H,1H3 |
| InChIKey | XDQMYAULDVWVPR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine?
The IUPAC name of 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine (CID 88573481) is 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine.
What is the SMILES notation for 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine?
The canonical SMILES for 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine is Cc1oc2nc(C(F)(F)F)ccc2c1C(F)(F)F.
What is the InChIKey of 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine?
The InChIKey is XDQMYAULDVWVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F6NO/c1-4-7(10(14,15)16)5-2-3-6(9(11,12)13)17-8(5)18-4/h2-3H,1H3.
What are the key properties of 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine?
2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine has a molecular weight of 269.14 g/mol, XLogP of 4.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,6-bis(trifluoromethyl)furo[2,3-b]pyridine is sourced from PubChem (CID 88573481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).