About 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole
7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole (PubChem CID 88573562) has the molecular formula C15H12BNOS
and a molecular weight of 265.15 g/mol. Its IUPAC name is 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole.
Molecular Properties
| Compound Name | 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole |
| PubChem CID | 88573562 |
| Molecular Formula | C15H12BNOS |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole |
| SMILES | [C-]#[N+]c1ccc(Sc2cccc3c2B(C)OC3)cc1 |
| InChI | InChI=1S/C15H12BNOS/c1-16-15-11(10-18-16)4-3-5-14(15)19-13-8-6-12(17-2)7-9-13/h3-9H,10H2,1H3 |
| InChIKey | FHMGDEPRZDCQOS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole?
The IUPAC name of 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole (CID 88573562) is 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole.
What is the SMILES notation for 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole?
The canonical SMILES for 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole is [C-]#[N+]c1ccc(Sc2cccc3c2B(C)OC3)cc1.
What is the InChIKey of 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole?
The InChIKey is FHMGDEPRZDCQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BNOS/c1-16-15-11(10-18-16)4-3-5-14(15)19-13-8-6-12(17-2)7-9-13/h3-9H,10H2,1H3.
What are the key properties of 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole?
7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole has a molecular weight of 265.15 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-isocyanophenyl)sulfanyl-1-methyl-3H-2,1-benzoxaborole is sourced from PubChem (CID 88573562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).