C24H46O7S — CID 88574138
2-[2,3-dimethyl-3-(2,2,11,11-tetramethyldodecanoyloxy)butan-2-yl]oxy-2-oxoethanesulfonic acid (PubChem CID 88574138) has the molecular formula C24H46O7S and a molecular weight of 478.69 g/mol. Its IUPAC name is 2-[2,3-dimethyl-3-(2,2,11,11-tetramethyldodecanoyloxy)butan-2-yl]oxy-2-oxoethanesulfonic acid.
| Compound Name | 2-[2,3-dimethyl-3-(2,2,11,11-tetramethyldodecanoyloxy)butan-2-yl]oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88574138 |
| Molecular Formula | C24H46O7S |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 2-[2,3-dimethyl-3-(2,2,11,11-tetramethyldodecanoyloxy)butan-2-yl]oxy-2-oxoethanesulfonic acid |
| SMILES | CC(C)(C)CCCCCCCCC(C)(C)C(=O)OC(C)(C)C(C)(C)OC(=O)CS(=O)(=O)O |
| InChI | InChI=1S/C24H46O7S/c1-21(2,3)16-14-12-10-11-13-15-17-22(4,5)20(26)31-24(8,9)23(6,7)30-19(25)18-32(27,28)29/h10-18H2,1-9H3,(H,27,28,29) |
| InChIKey | WTLNBCSSJMFRQO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|