C22H19ClF5N3O3 — CID 88574184
3-[[5-[3-chloro-4-[5-(1,1,2,2,2-pentafluoroethyl)-1H-imidazol-2-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoic acid (PubChem CID 88574184) has the molecular formula C22H19ClF5N3O3 and a molecular weight of 503.86 g/mol. Its IUPAC name is 3-[[5-[3-chloro-4-[5-(1,1,2,2,2-pentafluoroethyl)-1H-imidazol-2-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[5-[3-chloro-4-[5-(1,1,2,2,2-pentafluoroethyl)-1H-imidazol-2-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 88574184 |
| Molecular Formula | C22H19ClF5N3O3 |
| Molecular Weight | 503.86 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 3-[[5-[3-chloro-4-[5-(1,1,2,2,2-pentafluoroethyl)-1H-imidazol-2-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoic acid |
| SMILES | Cc1cc(OCC(C)(C)C(=O)O)ncc1-c1ccc(-c2ncc(C(F)(F)C(F)(F)F)[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C22H19ClF5N3O3/c1-11-6-17(34-10-20(2,3)19(32)33)29-8-14(11)12-4-5-13(15(23)7-12)18-30-9-16(31-18)21(24,25)22(26,27)28/h4-9H,10H2,1-3H3,(H,30,31)(H,32,33) |
| InChIKey | VZBBFPRXKYOPDX-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.86 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|