C12H25N4NaO3SSi — CID 88574420
sodium;6-amino-1H-1,3,5-triazine-2-thione;triethoxy(propyl)silane (PubChem CID 88574420) has the molecular formula C12H25N4NaO3SSi and a molecular weight of 356.50 g/mol. Its IUPAC name is sodium;6-amino-1H-1,3,5-triazine-2-thione;triethoxy(propyl)silane.
| Compound Name | sodium;6-amino-1H-1,3,5-triazine-2-thione;triethoxy(propyl)silane |
|---|---|
| PubChem CID | 88574420 |
| Molecular Formula | C12H25N4NaO3SSi |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | sodium;6-amino-1H-1,3,5-triazine-2-thione;triethoxy(propyl)silane |
| SMILES | Nc1ncnc(=S)[nH]1.[CH2-]CC[Si](OCC)(OCC)OCC.[Na+] |
| InChI | InChI=1S/C9H21O3Si.C3H4N4S.Na/c1-5-9-13(10-6-2,11-7-3)12-8-4;4-2-5-1-6-3(8)7-2;/h1,5-9H2,2-4H3;1H,(H3,4,5,6,7,8);/q-1;;+1 |
| InChIKey | BZSPCJVTQHDCRV-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|