About (3,4,5-trifluorophenyl) 2,2-difluoroacetate
(3,4,5-trifluorophenyl) 2,2-difluoroacetate (PubChem CID 88574463) has the molecular formula C8H3F5O2
and a molecular weight of 226.10 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 2,2-difluoroacetate.
Molecular Properties
| Compound Name | (3,4,5-trifluorophenyl) 2,2-difluoroacetate |
| PubChem CID | 88574463 |
| Molecular Formula | C8H3F5O2 |
| Molecular Weight | 226.10 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | (3,4,5-trifluorophenyl) 2,2-difluoroacetate |
| SMILES | O=C(Oc1cc(F)c(F)c(F)c1)C(F)F |
| InChI | InChI=1S/C8H3F5O2/c9-4-1-3(2-5(10)6(4)11)15-8(14)7(12)13/h1-2,7H |
| InChIKey | LJWHPDGOOHKFJV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.10 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3,4,5-trifluorophenyl) 2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,5-trifluorophenyl) 2,2-difluoroacetate?
The IUPAC name of (3,4,5-trifluorophenyl) 2,2-difluoroacetate (CID 88574463) is (3,4,5-trifluorophenyl) 2,2-difluoroacetate.
What is the SMILES notation for (3,4,5-trifluorophenyl) 2,2-difluoroacetate?
The canonical SMILES for (3,4,5-trifluorophenyl) 2,2-difluoroacetate is O=C(Oc1cc(F)c(F)c(F)c1)C(F)F.
What is the InChIKey of (3,4,5-trifluorophenyl) 2,2-difluoroacetate?
The InChIKey is LJWHPDGOOHKFJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F5O2/c9-4-1-3(2-5(10)6(4)11)15-8(14)7(12)13/h1-2,7H.
What are the key properties of (3,4,5-trifluorophenyl) 2,2-difluoroacetate?
(3,4,5-trifluorophenyl) 2,2-difluoroacetate has a molecular weight of 226.10 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,5-trifluorophenyl) 2,2-difluoroacetate is sourced from PubChem (CID 88574463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).