About (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate
(4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate (PubChem CID 88574501) has the molecular formula C13H15F3O3S
and a molecular weight of 308.32 g/mol. Its IUPAC name is (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate.
Molecular Properties
| Compound Name | (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate |
| PubChem CID | 88574501 |
| Molecular Formula | C13H15F3O3S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C2CCCC2)cc1)C(F)(F)CF |
| InChI | InChI=1S/C13H15F3O3S/c14-9-13(15,16)20(17,18)19-12-7-5-11(6-8-12)10-3-1-2-4-10/h5-8,10H,1-4,9H2 |
| InChIKey | IZMWZNFSFTZIQW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate?
The IUPAC name of (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate (CID 88574501) is (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate.
What is the SMILES notation for (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate?
The canonical SMILES for (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate is O=S(=O)(Oc1ccc(C2CCCC2)cc1)C(F)(F)CF.
What is the InChIKey of (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate?
The InChIKey is IZMWZNFSFTZIQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3O3S/c14-9-13(15,16)20(17,18)19-12-7-5-11(6-8-12)10-3-1-2-4-10/h5-8,10H,1-4,9H2.
What are the key properties of (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate?
(4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate has a molecular weight of 308.32 g/mol, XLogP of 3.62, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopentylphenyl) 1,1,2-trifluoroethanesulfonate is sourced from PubChem (CID 88574501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).