C18H33N3O3 — CID 88574919
2-[2-[1-(4-butan-2-ylphenoxy)ethoxy]ethylamino]-1,2-bis(methylamino)ethanol (PubChem CID 88574919) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[2-[1-(4-butan-2-ylphenoxy)ethoxy]ethylamino]-1,2-bis(methylamino)ethanol.
| Compound Name | 2-[2-[1-(4-butan-2-ylphenoxy)ethoxy]ethylamino]-1,2-bis(methylamino)ethanol |
|---|---|
| PubChem CID | 88574919 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | 2-[2-[1-(4-butan-2-ylphenoxy)ethoxy]ethylamino]-1,2-bis(methylamino)ethanol |
| SMILES | CCC(C)c1ccc(OC(C)OCCNC(NC)C(O)NC)cc1 |
| InChI | InChI=1S/C18H33N3O3/c1-6-13(2)15-7-9-16(10-8-15)24-14(3)23-12-11-21-17(19-4)18(22)20-5/h7-10,13-14,17-22H,6,11-12H2,1-5H3 |
| InChIKey | JCSFOZJWRWMNFR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|