C30H34FN3O2 — CID 88575080
N-(1-cyclohexyl-2-oxo-3H-indol-3-yl)-2-(4-fluoroanilino)-N-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]acetamide (PubChem CID 88575080) has the molecular formula C30H34FN3O2 and a molecular weight of 487.62 g/mol. Its IUPAC name is N-(1-cyclohexyl-2-oxo-3H-indol-3-yl)-2-(4-fluoroanilino)-N-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]acetamide.
| Compound Name | N-(1-cyclohexyl-2-oxo-3H-indol-3-yl)-2-(4-fluoroanilino)-N-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]acetamide |
|---|---|
| PubChem CID | 88575080 |
| Molecular Formula | C30H34FN3O2 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | N-(1-cyclohexyl-2-oxo-3H-indol-3-yl)-2-(4-fluoroanilino)-N-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]acetamide |
| SMILES | C=C(C)/C=C(/C=C\C)N(C(=O)CNc1ccc(F)cc1)C1C(=O)N(C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C30H34FN3O2/c1-4-10-25(19-21(2)3)34(28(35)20-32-23-17-15-22(31)16-18-23)29-26-13-8-9-14-27(26)33(30(29)36)24-11-6-5-7-12-24/h4,8-10,13-19,24,29,32H,2,5-7,11-12,20H2,1,3H3/b10-4+,25-19+ |
| InChIKey | PLWDEOJPZLHHOB-SIJWYMJZSA-N |
| XLogP | 6.52 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|