C13H19F6NO2S — CID 88575274
1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 88575274) has the molecular formula C13H19F6NO2S and a molecular weight of 367.36 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 88575274 |
| Molecular Formula | C13H19F6NO2S |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C13H19F6NO2S/c1-11(14,15)12(16,17)13(18,19)23(21,22)20-8-4-6-9-5-2-3-7-10(9)20/h9-10H,2-8H2,1H3 |
| InChIKey | MFVDYPDKPSVRSG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|