C23H25N2O3+ — CID 8857557
1-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone (PubChem CID 8857557) has the molecular formula C23H25N2O3+ and a molecular weight of 377.46 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8857557 |
| Molecular Formula | C23H25N2O3+ |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-(4-ethylpyridin-1-ium-1-yl)ethanone |
| SMILES | CCc1cc[n+](CC(=O)c2cc(C)n(Cc3ccc4c(c3)OCO4)c2C)cc1 |
| InChI | InChI=1S/C23H25N2O3/c1-4-18-7-9-24(10-8-18)14-21(26)20-11-16(2)25(17(20)3)13-19-5-6-22-23(12-19)28-15-27-22/h5-12H,4,13-15H2,1-3H3/q+1 |
| InChIKey | BWTXPYYOHUCLNX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|