C27H28F2N4O2 — CID 88575611
N-(2,6-difluorophenyl)-2-[4-[(2Z,4E)-6-piperidin-1-ylhexa-2,4-dien-3-yl]anilino]-1,3-oxazole-5-carboxamide (PubChem CID 88575611) has the molecular formula C27H28F2N4O2 and a molecular weight of 478.54 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-[4-[(2Z,4E)-6-piperidin-1-ylhexa-2,4-dien-3-yl]anilino]-1,3-oxazole-5-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-2-[4-[(2Z,4E)-6-piperidin-1-ylhexa-2,4-dien-3-yl]anilino]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 88575611 |
| Molecular Formula | C27H28F2N4O2 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-[4-[(2Z,4E)-6-piperidin-1-ylhexa-2,4-dien-3-yl]anilino]-1,3-oxazole-5-carboxamide |
| SMILES | C/C=C(/C=C/CN1CCCCC1)c1ccc(Nc2ncc(C(=O)Nc3c(F)cccc3F)o2)cc1 |
| InChI | InChI=1S/C27H28F2N4O2/c1-2-19(8-7-17-33-15-4-3-5-16-33)20-11-13-21(14-12-20)31-27-30-18-24(35-27)26(34)32-25-22(28)9-6-10-23(25)29/h2,6-14,18H,3-5,15-17H2,1H3,(H,30,31)(H,32,34)/b8-7+,19-2- |
| InChIKey | AMIQJEGNZJXYDK-PGTUFNBASA-N |
| XLogP | 6.39 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|