About 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline
5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline (PubChem CID 88575613) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline.
Molecular Properties
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline |
| PubChem CID | 88575613 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline |
| SMILES | C=C/C=C\c1cccc2c1CN=CN2 |
| InChI | InChI=1S/C12H12N2/c1-2-3-5-10-6-4-7-12-11(10)8-13-9-14-12/h2-7,9H,1,8H2,(H,13,14)/b5-3- |
| InChIKey | UFOFMHXFPWJSJZ-HYXAFXHYSA-N |
| XLogP | 2.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline?
The IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline (CID 88575613) is 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline.
What is the SMILES notation for 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline?
The canonical SMILES for 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline is C=C/C=C\c1cccc2c1CN=CN2.
What is the InChIKey of 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline?
The InChIKey is UFOFMHXFPWJSJZ-HYXAFXHYSA-N. The full InChI is InChI=1S/C12H12N2/c1-2-3-5-10-6-4-7-12-11(10)8-13-9-14-12/h2-7,9H,1,8H2,(H,13,14)/b5-3-.
What are the key properties of 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline?
5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline has a molecular weight of 184.24 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1Z)-buta-1,3-dienyl]-1,4-dihydroquinazoline is sourced from PubChem (CID 88575613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).