About 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde
5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde (PubChem CID 88575648) has the molecular formula C24H17F2N3O2
and a molecular weight of 417.42 g/mol. Its IUPAC name is 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde.
Molecular Properties
| Compound Name | 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde |
| PubChem CID | 88575648 |
| Molecular Formula | C24H17F2N3O2 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde |
| SMILES | Cc1ccc(Oc2nc3c(F)c(-c4ccc5c(ccn5C)c4)c(F)cc3[nH]2)cc1C=O |
| InChI | InChI=1S/C24H17F2N3O2/c1-13-3-5-17(10-16(13)12-30)31-24-27-19-11-18(25)21(22(26)23(19)28-24)15-4-6-20-14(9-15)7-8-29(20)2/h3-12H,1-2H3,(H,27,28) |
| InChIKey | IYVMAXZBEVUQIL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde?
The IUPAC name of 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde (CID 88575648) is 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde.
What is the SMILES notation for 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde?
The canonical SMILES for 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde is Cc1ccc(Oc2nc3c(F)c(-c4ccc5c(ccn5C)c4)c(F)cc3[nH]2)cc1C=O.
What is the InChIKey of 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde?
The InChIKey is IYVMAXZBEVUQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17F2N3O2/c1-13-3-5-17(10-16(13)12-30)31-24-27-19-11-18(25)21(22(26)23(19)28-24)15-4-6-20-14(9-15)7-8-29(20)2/h3-12H,1-2H3,(H,27,28).
What are the key properties of 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde?
5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde has a molecular weight of 417.42 g/mol, XLogP of 5.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzaldehyde is sourced from PubChem (CID 88575648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).