About sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium
sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium (PubChem CID 88575659) has the molecular formula C6H7N9PS+
and a molecular weight of 268.23 g/mol. Its IUPAC name is sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium.
Molecular Properties
| Compound Name | sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium |
| PubChem CID | 88575659 |
| Molecular Formula | C6H7N9PS+ |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium |
| SMILES | S[P+](n1cncn1)(n1cncn1)n1cncn1 |
| InChI | InChI=1S/C6H7N9PS/c17-16(13-4-7-1-10-13,14-5-8-2-11-14)15-6-9-3-12-15/h1-6,17H/q+1 |
| InChIKey | AGNULONZTWICTL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium?
The IUPAC name of sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium (CID 88575659) is sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium.
What is the SMILES notation for sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium?
The canonical SMILES for sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium is S[P+](n1cncn1)(n1cncn1)n1cncn1.
What is the InChIKey of sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium?
The InChIKey is AGNULONZTWICTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N9PS/c17-16(13-4-7-1-10-13,14-5-8-2-11-14)15-6-9-3-12-15/h1-6,17H/q+1.
What are the key properties of sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium?
sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium has a molecular weight of 268.23 g/mol, XLogP of 0.01, 3 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanyl-tris(1,2,4-triazol-1-yl)phosphanium is sourced from PubChem (CID 88575659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).